C16H14F5NO3S — CID 133275361
4-(difluoromethylsulfonyl)-N-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]aniline (PubChem CID 133275361) has the molecular formula C16H14F5NO3S and a molecular weight of 395.35 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 133275361 |
| Molecular Formula | C16H14F5NO3S |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]aniline |
| SMILES | COc1ccc(CNc2ccc(S(=O)(=O)C(F)F)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F5NO3S/c1-25-12-5-2-10(14(8-12)16(19,20)21)9-22-11-3-6-13(7-4-11)26(23,24)15(17)18/h2-8,15,22H,9H2,1H3 |
| InChIKey | KNMFNCWYASZGKP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |