C18H25N5O4 — CID 133277887
N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-1,3-dimethyl-4-nitropyrazol-5-amine (PubChem CID 133277887) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-1,3-dimethyl-4-nitropyrazol-5-amine.
| Compound Name | N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-1,3-dimethyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 133277887 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-1,3-dimethyl-4-nitropyrazol-5-amine |
| SMILES | COc1cc2c(cc1OC)CN(CCNc1c([N+](=O)[O-])c(C)nn1C)CC2 |
| InChI | InChI=1S/C18H25N5O4/c1-12-17(23(24)25)18(21(2)20-12)19-6-8-22-7-5-13-9-15(26-3)16(27-4)10-14(13)11-22/h9-10,19H,5-8,11H2,1-4H3 |
| InChIKey | MXICCJFTNJHYEV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|