C23H24N6S — CID 133280230
4-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]-2-thiophen-3-ylquinazoline (PubChem CID 133280230) has the molecular formula C23H24N6S and a molecular weight of 416.55 g/mol. Its IUPAC name is 4-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]-2-thiophen-3-ylquinazoline.
| Compound Name | 4-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]-2-thiophen-3-ylquinazoline |
|---|---|
| PubChem CID | 133280230 |
| Molecular Formula | C23H24N6S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]-2-thiophen-3-ylquinazoline |
| SMILES | c1ccc2c(N3CCCCC3c3nnc4n3CCCC4)nc(-c3ccsc3)nc2c1 |
| InChI | InChI=1S/C23H24N6S/c1-2-8-18-17(7-1)22(25-21(24-18)16-11-14-30-15-16)28-12-5-3-9-19(28)23-27-26-20-10-4-6-13-29(20)23/h1-2,7-8,11,14-15,19H,3-6,9-10,12-13H2 |
| InChIKey | MXGBFRYQTVGTSW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |