C19H24F2N4O2S — CID 133300147
2-(difluoromethylsulfonyl)-N-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]aniline (PubChem CID 133300147) has the molecular formula C19H24F2N4O2S and a molecular weight of 410.49 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-N-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]aniline.
| Compound Name | 2-(difluoromethylsulfonyl)-N-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]aniline |
|---|---|
| PubChem CID | 133300147 |
| Molecular Formula | C19H24F2N4O2S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-N-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]aniline |
| SMILES | CCN1CCN(c2cc(CNc3ccccc3S(=O)(=O)C(F)F)ccn2)CC1 |
| InChI | InChI=1S/C19H24F2N4O2S/c1-2-24-9-11-25(12-10-24)18-13-15(7-8-22-18)14-23-16-5-3-4-6-17(16)28(26,27)19(20)21/h3-8,13,19,23H,2,9-12,14H2,1H3 |
| InChIKey | CESYBDDRKAHBKN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |