C21H26FN5 — CID 167766244
1-[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]-N-[(4-fluoro-1H-indol-2-yl)methyl]methanamine (PubChem CID 167766244) has the molecular formula C21H26FN5 and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]-N-[(4-fluoro-1H-indol-2-yl)methyl]methanamine.
| Compound Name | 1-[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]-N-[(4-fluoro-1H-indol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 167766244 |
| Molecular Formula | C21H26FN5 |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 1-[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]-N-[(4-fluoro-1H-indol-2-yl)methyl]methanamine |
| SMILES | CCN1CCN(c2cc(CNCc3cc4c(F)cccc4[nH]3)ccn2)CC1 |
| InChI | InChI=1S/C21H26FN5/c1-2-26-8-10-27(11-9-26)21-12-16(6-7-24-21)14-23-15-17-13-18-19(22)4-3-5-20(18)25-17/h3-7,12-13,23,25H,2,8-11,14-15H2,1H3 |
| InChIKey | FVHGHBRIFJYTMP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |