C19H17BrN2O4 — CID 133305414
1-(1,3-benzodioxol-5-yloxy)-3-[(8-bromoquinolin-4-yl)amino]propan-2-ol (PubChem CID 133305414) has the molecular formula C19H17BrN2O4 and a molecular weight of 417.26 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yloxy)-3-[(8-bromoquinolin-4-yl)amino]propan-2-ol.
| Compound Name | 1-(1,3-benzodioxol-5-yloxy)-3-[(8-bromoquinolin-4-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 133305414 |
| Molecular Formula | C19H17BrN2O4 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yloxy)-3-[(8-bromoquinolin-4-yl)amino]propan-2-ol |
| SMILES | OC(CNc1ccnc2c(Br)cccc12)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H17BrN2O4/c20-15-3-1-2-14-16(6-7-21-19(14)15)22-9-12(23)10-24-13-4-5-17-18(8-13)26-11-25-17/h1-8,12,23H,9-11H2,(H,21,22) |
| InChIKey | ONFOWENPFORSKE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |