C12H16ClN5O2 — CID 133305646
5-chloro-4-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propylamino]-1H-pyridazin-6-one (PubChem CID 133305646) has the molecular formula C12H16ClN5O2 and a molecular weight of 297.75 g/mol. Its IUPAC name is 5-chloro-4-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propylamino]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propylamino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 133305646 |
| Molecular Formula | C12H16ClN5O2 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 5-chloro-4-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propylamino]-1H-pyridazin-6-one |
| SMILES | CC(C)c1noc(CCCNc2cn[nH]c(=O)c2Cl)n1 |
| InChI | InChI=1S/C12H16ClN5O2/c1-7(2)11-16-9(20-18-11)4-3-5-14-8-6-15-17-12(19)10(8)13/h6-7H,3-5H2,1-2H3,(H2,14,17,19) |
| InChIKey | IQFNYZJAQHNBTG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|