C15H15F3N4OS — CID 133311205
3-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one (PubChem CID 133311205) has the molecular formula C15H15F3N4OS and a molecular weight of 356.37 g/mol. Its IUPAC name is 3-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one.
| Compound Name | 3-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 133311205 |
| Molecular Formula | C15H15F3N4OS |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 3-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one |
| SMILES | O=C1C(Nc2ncnc3sc4c(c23)CCC4)CCN1CC(F)(F)F |
| InChI | InChI=1S/C15H15F3N4OS/c16-15(17,18)6-22-5-4-9(14(22)23)21-12-11-8-2-1-3-10(8)24-13(11)20-7-19-12/h7,9H,1-6H2,(H,19,20,21) |
| InChIKey | PUXKHHZIFZCQCL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |