C17H22N6 — CID 133312537
N-(2,2-dimethyl-5-phenylpentyl)tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 133312537) has the molecular formula C17H22N6 and a molecular weight of 310.41 g/mol. Its IUPAC name is N-(2,2-dimethyl-5-phenylpentyl)tetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-(2,2-dimethyl-5-phenylpentyl)tetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133312537 |
| Molecular Formula | C17H22N6 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N-(2,2-dimethyl-5-phenylpentyl)tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CC(C)(CCCc1ccccc1)CNc1ccc2nnnn2n1 |
| InChI | InChI=1S/C17H22N6/c1-17(2,12-6-9-14-7-4-3-5-8-14)13-18-15-10-11-16-19-21-22-23(16)20-15/h3-5,7-8,10-11H,6,9,12-13H2,1-2H3,(H,18,20) |
| InChIKey | XYKFVQPJYJOUTJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |