About 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol
3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol (PubChem CID 133314249) has the molecular formula C15H13FN2O2
and a molecular weight of 272.28 g/mol. Its IUPAC name is 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol.
Molecular Properties
| Compound Name | 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol |
| PubChem CID | 133314249 |
| Molecular Formula | C15H13FN2O2 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol |
| SMILES | Oc1cccc(CCNc2nc3cc(F)ccc3o2)c1 |
| InChI | InChI=1S/C15H13FN2O2/c16-11-4-5-14-13(9-11)18-15(20-14)17-7-6-10-2-1-3-12(19)8-10/h1-5,8-9,19H,6-7H2,(H,17,18) |
| InChIKey | DKQSIXBHEDNBGV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol?
The IUPAC name of 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol (CID 133314249) is 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol.
What is the SMILES notation for 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol?
The canonical SMILES for 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol is Oc1cccc(CCNc2nc3cc(F)ccc3o2)c1.
What is the InChIKey of 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol?
The InChIKey is DKQSIXBHEDNBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FN2O2/c16-11-4-5-14-13(9-11)18-15(20-14)17-7-6-10-2-1-3-12(19)8-10/h1-5,8-9,19H,6-7H2,(H,17,18).
What are the key properties of 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol?
3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol has a molecular weight of 272.28 g/mol, XLogP of 3.33, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]phenol is sourced from PubChem (CID 133314249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).