C14H10ClF2N3O2 — CID 133334072
3-chloro-6-[3-(difluoromethoxy)-4-methoxyanilino]pyridine-2-carbonitrile (PubChem CID 133334072) has the molecular formula C14H10ClF2N3O2 and a molecular weight of 325.70 g/mol. Its IUPAC name is 3-chloro-6-[3-(difluoromethoxy)-4-methoxyanilino]pyridine-2-carbonitrile.
| Compound Name | 3-chloro-6-[3-(difluoromethoxy)-4-methoxyanilino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133334072 |
| Molecular Formula | C14H10ClF2N3O2 |
| Molecular Weight | 325.70 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 3-chloro-6-[3-(difluoromethoxy)-4-methoxyanilino]pyridine-2-carbonitrile |
| SMILES | COc1ccc(Nc2ccc(Cl)c(C#N)n2)cc1OC(F)F |
| InChI | InChI=1S/C14H10ClF2N3O2/c1-21-11-4-2-8(6-12(11)22-14(16)17)19-13-5-3-9(15)10(7-18)20-13/h2-6,14H,1H3,(H,19,20) |
| InChIKey | DTOQBRXNFNWPJI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.70 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |