C16H18F3N5O2S — CID 133334832
3-ethyl-5-[4-[4-nitro-2-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]-1,2,4-thiadiazole (PubChem CID 133334832) has the molecular formula C16H18F3N5O2S and a molecular weight of 401.41 g/mol. Its IUPAC name is 3-ethyl-5-[4-[4-nitro-2-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]-1,2,4-thiadiazole.
| Compound Name | 3-ethyl-5-[4-[4-nitro-2-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 133334832 |
| Molecular Formula | C16H18F3N5O2S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-ethyl-5-[4-[4-nitro-2-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]-1,2,4-thiadiazole |
| SMILES | CCc1nsc(N2CCCN(c3ccc([N+](=O)[O-])cc3C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C16H18F3N5O2S/c1-2-14-20-15(27-21-14)23-7-3-6-22(8-9-23)13-5-4-11(24(25)26)10-12(13)16(17,18)19/h4-5,10H,2-3,6-9H2,1H3 |
| InChIKey | CYFPEWQDBDIVHX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|