C22H22N4O4S — CID 133346802
N-[3-[[2-methoxy-1-(5-methylfuran-2-yl)ethyl]amino]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 133346802) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is N-[3-[[2-methoxy-1-(5-methylfuran-2-yl)ethyl]amino]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | N-[3-[[2-methoxy-1-(5-methylfuran-2-yl)ethyl]amino]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 133346802 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-[3-[[2-methoxy-1-(5-methylfuran-2-yl)ethyl]amino]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | COCC(Nc1nc2ccccc2nc1NS(=O)(=O)c1ccccc1)c1ccc(C)o1 |
| InChI | InChI=1S/C22H22N4O4S/c1-15-12-13-20(30-15)19(14-29-2)25-21-22(24-18-11-7-6-10-17(18)23-21)26-31(27,28)16-8-4-3-5-9-16/h3-13,19H,14H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | IEULAVNUFPLKOW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |