C15H14ClF2N3O2S — CID 133352307
1-(3-chloro-4-pyridinyl)-4-(3,4-difluorophenyl)sulfonylpiperazine (PubChem CID 133352307) has the molecular formula C15H14ClF2N3O2S and a molecular weight of 373.81 g/mol. Its IUPAC name is 1-(3-chloro-4-pyridinyl)-4-(3,4-difluorophenyl)sulfonylpiperazine.
| Compound Name | 1-(3-chloro-4-pyridinyl)-4-(3,4-difluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 133352307 |
| Molecular Formula | C15H14ClF2N3O2S |
| Molecular Weight | 373.81 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 1-(3-chloro-4-pyridinyl)-4-(3,4-difluorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N1CCN(c2ccncc2Cl)CC1 |
| InChI | InChI=1S/C15H14ClF2N3O2S/c16-12-10-19-4-3-15(12)20-5-7-21(8-6-20)24(22,23)11-1-2-13(17)14(18)9-11/h1-4,9-10H,5-8H2 |
| InChIKey | MKFWYHUMVIFSSZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.81 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |