C15H7ClF4N4O — CID 133372743
N-[4-(6-chloropyridazin-3-yl)oxyphenyl]-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 133372743) has the molecular formula C15H7ClF4N4O and a molecular weight of 370.69 g/mol. Its IUPAC name is N-[4-(6-chloropyridazin-3-yl)oxyphenyl]-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-[4-(6-chloropyridazin-3-yl)oxyphenyl]-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 133372743 |
| Molecular Formula | C15H7ClF4N4O |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | N-[4-(6-chloropyridazin-3-yl)oxyphenyl]-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(Nc2ccc(Oc3ccc(Cl)nn3)cc2)c1F |
| InChI | InChI=1S/C15H7ClF4N4O/c16-9-5-6-10(24-23-9)25-8-3-1-7(2-4-8)21-13-11(17)14(19)22-15(20)12(13)18/h1-6H,(H,21,22) |
| InChIKey | WVEMQGRFVWSDQM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|