C18H13F3N2O2S — CID 133382101
N-benzyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]benzamide (PubChem CID 133382101) has the molecular formula C18H13F3N2O2S and a molecular weight of 378.38 g/mol. Its IUPAC name is N-benzyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]benzamide.
| Compound Name | N-benzyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]benzamide |
|---|---|
| PubChem CID | 133382101 |
| Molecular Formula | C18H13F3N2O2S |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-benzyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]benzamide |
| SMILES | O=C(NCc1ccccc1)c1cccc(Oc2nc(C(F)(F)F)cs2)c1 |
| InChI | InChI=1S/C18H13F3N2O2S/c19-18(20,21)15-11-26-17(23-15)25-14-8-4-7-13(9-14)16(24)22-10-12-5-2-1-3-6-12/h1-9,11H,10H2,(H,22,24) |
| InChIKey | IAACTRWVQRGNST-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |