C14H13NO — CID 13339146
spiro[chromene-2,1'-cyclopentane]-4-carbonitrile (PubChem CID 13339146) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is spiro[chromene-2,1'-cyclopentane]-4-carbonitrile.
| Compound Name | spiro[chromene-2,1'-cyclopentane]-4-carbonitrile |
|---|---|
| PubChem CID | 13339146 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | spiro[chromene-2,1'-cyclopentane]-4-carbonitrile |
| SMILES | N#CC1=CC2(CCCC2)Oc2ccccc21 |
| InChI | InChI=1S/C14H13NO/c15-10-11-9-14(7-3-4-8-14)16-13-6-2-1-5-12(11)13/h1-2,5-6,9H,3-4,7-8H2 |
| InChIKey | QXUURTTXKMEPKF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |