C16H18N4O2S2 — CID 133395378
5-methyl-N-[2-[(6-methylquinazolin-4-yl)amino]ethyl]thiophene-2-sulfonamide (PubChem CID 133395378) has the molecular formula C16H18N4O2S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 5-methyl-N-[2-[(6-methylquinazolin-4-yl)amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[2-[(6-methylquinazolin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133395378 |
| Molecular Formula | C16H18N4O2S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 5-methyl-N-[2-[(6-methylquinazolin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc2ncnc(NCCNS(=O)(=O)c3ccc(C)s3)c2c1 |
| InChI | InChI=1S/C16H18N4O2S2/c1-11-3-5-14-13(9-11)16(19-10-18-14)17-7-8-20-24(21,22)15-6-4-12(2)23-15/h3-6,9-10,20H,7-8H2,1-2H3,(H,17,18,19) |
| InChIKey | PNWLDYZPRWNFRD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|