C12H13N5OS3 — CID 133407778
N-(2-methoxyethyl)-5-(6-methylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-1,3,4-thiadiazol-2-amine (PubChem CID 133407778) has the molecular formula C12H13N5OS3 and a molecular weight of 339.47 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-(6-methylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-methoxyethyl)-5-(6-methylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133407778 |
| Molecular Formula | C12H13N5OS3 |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | N-(2-methoxyethyl)-5-(6-methylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-1,3,4-thiadiazol-2-amine |
| SMILES | COCCNc1nnc(Sc2ncnc3sc(C)cc23)s1 |
| InChI | InChI=1S/C12H13N5OS3/c1-7-5-8-9(19-7)14-6-15-10(8)20-12-17-16-11(21-12)13-3-4-18-2/h5-6H,3-4H2,1-2H3,(H,13,16) |
| InChIKey | IZIVUEXBTWCUHV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|