C22H25N3O5S — CID 133413392
4'-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)spiro[1,2-dihydroindene-3,2'-morpholine] (PubChem CID 133413392) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 4'-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)spiro[1,2-dihydroindene-3,2'-morpholine].
| Compound Name | 4'-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)spiro[1,2-dihydroindene-3,2'-morpholine] |
|---|---|
| PubChem CID | 133413392 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4'-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)spiro[1,2-dihydroindene-3,2'-morpholine] |
| SMILES | O=[N+]([O-])c1ccc(N2CCOC3(CCc4ccccc43)C2)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C22H25N3O5S/c26-25(27)18-7-8-20(21(15-18)31(28,29)24-11-3-4-12-24)23-13-14-30-22(16-23)10-9-17-5-1-2-6-19(17)22/h1-2,5-8,15H,3-4,9-14,16H2 |
| InChIKey | UICFPTFVXNKTJB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|