C19H21N5O4 — CID 133419805
N-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]methyl]-3-nitroimidazo[1,2-b]pyridazin-6-amine (PubChem CID 133419805) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]methyl]-3-nitroimidazo[1,2-b]pyridazin-6-amine.
| Compound Name | N-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]methyl]-3-nitroimidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133419805 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]methyl]-3-nitroimidazo[1,2-b]pyridazin-6-amine |
| SMILES | Cc1ccc(CNc2ccc3ncc([N+](=O)[O-])n3n2)c(OCC2CCCO2)c1 |
| InChI | InChI=1S/C19H21N5O4/c1-13-4-5-14(16(9-13)28-12-15-3-2-8-27-15)10-20-17-6-7-18-21-11-19(24(25)26)23(18)22-17/h4-7,9,11,15H,2-3,8,10,12H2,1H3,(H,20,22) |
| InChIKey | BLYFTFKJIUJARX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|