C20H16Cl2N4O4 — CID 133435952
4-chloro-5-[(9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]-2-(4-nitrophenyl)pyridazin-3-one (PubChem CID 133435952) has the molecular formula C20H16Cl2N4O4 and a molecular weight of 447.28 g/mol. Its IUPAC name is 4-chloro-5-[(9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]-2-(4-nitrophenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[(9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]-2-(4-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 133435952 |
| Molecular Formula | C20H16Cl2N4O4 |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 4-chloro-5-[(9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]-2-(4-nitrophenyl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NC2CCCOc3c(Cl)cccc32)cnn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H16Cl2N4O4/c21-15-4-1-3-14-16(5-2-10-30-19(14)15)24-17-11-23-25(20(27)18(17)22)12-6-8-13(9-7-12)26(28)29/h1,3-4,6-9,11,16,24H,2,5,10H2 |
| InChIKey | NQNYDHCVCGSELH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|