C15H20N6O4S — CID 133455246
3-[4-(4-ethyl-1,2,4-triazol-3-yl)piperidin-1-yl]-2-nitrobenzenesulfonamide (PubChem CID 133455246) has the molecular formula C15H20N6O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is 3-[4-(4-ethyl-1,2,4-triazol-3-yl)piperidin-1-yl]-2-nitrobenzenesulfonamide.
| Compound Name | 3-[4-(4-ethyl-1,2,4-triazol-3-yl)piperidin-1-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133455246 |
| Molecular Formula | C15H20N6O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-[4-(4-ethyl-1,2,4-triazol-3-yl)piperidin-1-yl]-2-nitrobenzenesulfonamide |
| SMILES | CCn1cnnc1C1CCN(c2cccc(S(N)(=O)=O)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H20N6O4S/c1-2-19-10-17-18-15(19)11-6-8-20(9-7-11)12-4-3-5-13(26(16,24)25)14(12)21(22)23/h3-5,10-11H,2,6-9H2,1H3,(H2,16,24,25) |
| InChIKey | WOUZGTKIIWVSLN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 137.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|