C17H19F3N2O4S — CID 133475352
N-[[5-(morpholin-4-ylmethyl)furan-2-yl]methyl]-4-(trifluoromethylsulfonyl)aniline (PubChem CID 133475352) has the molecular formula C17H19F3N2O4S and a molecular weight of 404.41 g/mol. Its IUPAC name is N-[[5-(morpholin-4-ylmethyl)furan-2-yl]methyl]-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-[[5-(morpholin-4-ylmethyl)furan-2-yl]methyl]-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 133475352 |
| Molecular Formula | C17H19F3N2O4S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[[5-(morpholin-4-ylmethyl)furan-2-yl]methyl]-4-(trifluoromethylsulfonyl)aniline |
| SMILES | O=S(=O)(c1ccc(NCc2ccc(CN3CCOCC3)o2)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H19F3N2O4S/c18-17(19,20)27(23,24)16-5-1-13(2-6-16)21-11-14-3-4-15(26-14)12-22-7-9-25-10-8-22/h1-6,21H,7-12H2 |
| InChIKey | KBHLOBNWQIZNRG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |