C12H13F3N4S2 — CID 133492419
N-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 133492419) has the molecular formula C12H13F3N4S2 and a molecular weight of 334.39 g/mol. Its IUPAC name is N-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133492419 |
| Molecular Formula | C12H13F3N4S2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | N-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CN(Cc1nc2c(s1)CCCC2)c1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C12H13F3N4S2/c1-19(11-18-17-10(21-11)12(13,14)15)6-9-16-7-4-2-3-5-8(7)20-9/h2-6H2,1H3 |
| InChIKey | RKXKZISWKIAKKT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |