C26H32N3O7P — CID 13363768
pyridin-2-ylmethyl 5-di(propan-2-yloxy)phosphoryl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 13363768) has the molecular formula C26H32N3O7P and a molecular weight of 529.53 g/mol. Its IUPAC name is pyridin-2-ylmethyl 5-di(propan-2-yloxy)phosphoryl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | pyridin-2-ylmethyl 5-di(propan-2-yloxy)phosphoryl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 13363768 |
| Molecular Formula | C26H32N3O7P |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | pyridin-2-ylmethyl 5-di(propan-2-yloxy)phosphoryl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccn2)C(c2cccc([N+](=O)[O-])c2)C(P(=O)(OC(C)C)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C26H32N3O7P/c1-16(2)35-37(33,36-17(3)4)25-19(6)28-18(5)23(26(30)34-15-21-11-7-8-13-27-21)24(25)20-10-9-12-22(14-20)29(31)32/h7-14,16-17,24,28H,15H2,1-6H3 |
| InChIKey | QNPNOVVMOLGMJO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|