C21H30Cl2N2O3 — CID 13375664
2-(3,4-dichlorophenyl)-N-(4,4-dimethoxy-2-pyrrolidin-1-ylcyclohexyl)-N-methylacetamide (PubChem CID 13375664) has the molecular formula C21H30Cl2N2O3 and a molecular weight of 429.39 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(4,4-dimethoxy-2-pyrrolidin-1-ylcyclohexyl)-N-methylacetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(4,4-dimethoxy-2-pyrrolidin-1-ylcyclohexyl)-N-methylacetamide |
|---|---|
| PubChem CID | 13375664 |
| Molecular Formula | C21H30Cl2N2O3 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(4,4-dimethoxy-2-pyrrolidin-1-ylcyclohexyl)-N-methylacetamide |
| SMILES | COC1(OC)CCC(N(C)C(=O)Cc2ccc(Cl)c(Cl)c2)C(N2CCCC2)C1 |
| InChI | InChI=1S/C21H30Cl2N2O3/c1-24(20(26)13-15-6-7-16(22)17(23)12-15)18-8-9-21(27-2,28-3)14-19(18)25-10-4-5-11-25/h6-7,12,18-19H,4-5,8-11,13-14H2,1-3H3 |
| InChIKey | CJXFLFBIDKDMGS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|