C23H34Cl2N2OS2 — CID 22120699
N-[5,5-bis(ethylsulfanyl)-2-pyrrolidin-1-ylcyclohexyl]-2-(3,4-dichlorophenyl)-N-methylacetamide (PubChem CID 22120699) has the molecular formula C23H34Cl2N2OS2 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-[5,5-bis(ethylsulfanyl)-2-pyrrolidin-1-ylcyclohexyl]-2-(3,4-dichlorophenyl)-N-methylacetamide.
| Compound Name | N-[5,5-bis(ethylsulfanyl)-2-pyrrolidin-1-ylcyclohexyl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 22120699 |
| Molecular Formula | C23H34Cl2N2OS2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | N-[5,5-bis(ethylsulfanyl)-2-pyrrolidin-1-ylcyclohexyl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
| SMILES | CCSC1(SCC)CCC(N2CCCC2)C(N(C)C(=O)Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C23H34Cl2N2OS2/c1-4-29-23(30-5-2)11-10-20(27-12-6-7-13-27)21(16-23)26(3)22(28)15-17-8-9-18(24)19(25)14-17/h8-9,14,20-21H,4-7,10-13,15-16H2,1-3H3 |
| InChIKey | KGPXCNXFDGZDQZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|