C19H25Cl3N2O — CID 54611533
2-(3,4-dichlorophenyl)-N-[(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexyl]-N-methylacetamide;hydrochloride (PubChem CID 54611533) has the molecular formula C19H25Cl3N2O and a molecular weight of 403.78 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexyl]-N-methylacetamide;hydrochloride.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexyl]-N-methylacetamide;hydrochloride |
|---|---|
| PubChem CID | 54611533 |
| Molecular Formula | C19H25Cl3N2O |
| Molecular Weight | 403.78 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexyl]-N-methylacetamide;hydrochloride |
| SMILES | CN(C(=O)Cc1ccc(Cl)c(Cl)c1)[C@H]1CCCC[C@@H]1N1CC=CC1.Cl |
| InChI | InChI=1S/C19H24Cl2N2O.ClH/c1-22(19(24)13-14-8-9-15(20)16(21)12-14)17-6-2-3-7-18(17)23-10-4-5-11-23;/h4-5,8-9,12,17-18H,2-3,6-7,10-11,13H2,1H3;1H/t17-,18-;/m0./s1 |
| InChIKey | IMSCRKBBJAGENW-APTPAJQOSA-N |
| XLogP | 4.60 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|