C19H27Cl3N2O — CID 22161806
2-(3,4-dichlorophenyl)-N-methyl-N-(1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-8-yl)acetamide;hydrochloride (PubChem CID 22161806) has the molecular formula C19H27Cl3N2O and a molecular weight of 405.80 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-methyl-N-(1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-8-yl)acetamide;hydrochloride.
| Compound Name | 2-(3,4-dichlorophenyl)-N-methyl-N-(1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-8-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 22161806 |
| Molecular Formula | C19H27Cl3N2O |
| Molecular Weight | 405.80 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-methyl-N-(1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-8-yl)acetamide;hydrochloride |
| SMILES | CN1CCCC2CCCC(N(C)C(=O)Cc3ccc(Cl)c(Cl)c3)C21.Cl |
| InChI | InChI=1S/C19H26Cl2N2O.ClH/c1-22-10-4-6-14-5-3-7-17(19(14)22)23(2)18(24)12-13-8-9-15(20)16(21)11-13;/h8-9,11,14,17,19H,3-7,10,12H2,1-2H3;1H |
| InChIKey | CCHNDBGDMKIVDS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.80 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |