C21H28Cl2N2O2S — CID 20517845
2-(3,4-dichlorophenyl)-N-methyl-N-(7-pyrrolidin-1-yl-1,4-dioxaspiro[4.5]decan-8-yl)ethanethioamide (PubChem CID 20517845) has the molecular formula C21H28Cl2N2O2S and a molecular weight of 443.44 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-methyl-N-(7-pyrrolidin-1-yl-1,4-dioxaspiro[4.5]decan-8-yl)ethanethioamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-methyl-N-(7-pyrrolidin-1-yl-1,4-dioxaspiro[4.5]decan-8-yl)ethanethioamide |
|---|---|
| PubChem CID | 20517845 |
| Molecular Formula | C21H28Cl2N2O2S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-methyl-N-(7-pyrrolidin-1-yl-1,4-dioxaspiro[4.5]decan-8-yl)ethanethioamide |
| SMILES | CN(C(=S)Cc1ccc(Cl)c(Cl)c1)C1CCC2(CC1N1CCCC1)OCCO2 |
| InChI | InChI=1S/C21H28Cl2N2O2S/c1-24(20(28)13-15-4-5-16(22)17(23)12-15)18-6-7-21(26-10-11-27-21)14-19(18)25-8-2-3-9-25/h4-5,12,18-19H,2-3,6-11,13-14H2,1H3 |
| InChIKey | ZWNADYDNSDYWGN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|