C4H8N4O2 — CID 13380517
4-methyl-1,3-dinitrosoimidazolidine (PubChem CID 13380517) has the molecular formula C4H8N4O2 and a molecular weight of 144.13 g/mol. Its IUPAC name is 4-methyl-1,3-dinitrosoimidazolidine.
| Compound Name | 4-methyl-1,3-dinitrosoimidazolidine |
|---|---|
| PubChem CID | 13380517 |
| Molecular Formula | C4H8N4O2 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 4-methyl-1,3-dinitrosoimidazolidine |
| SMILES | CC1CN(N=O)CN1N=O |
| InChI | InChI=1S/C4H8N4O2/c1-4-2-7(5-9)3-8(4)6-10/h4H,2-3H2,1H3 |
| InChIKey | CQPQMRCVCLEYCC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|