C11H15NO3 — CID 13387301
1-[(dimethylamino)methyl]-1,3-dihydro-2-benzofuran-4,5-diol (PubChem CID 13387301) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-[(dimethylamino)methyl]-1,3-dihydro-2-benzofuran-4,5-diol.
| Compound Name | 1-[(dimethylamino)methyl]-1,3-dihydro-2-benzofuran-4,5-diol |
|---|---|
| PubChem CID | 13387301 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-[(dimethylamino)methyl]-1,3-dihydro-2-benzofuran-4,5-diol |
| SMILES | CN(C)CC1OCc2c1ccc(O)c2O |
| InChI | InChI=1S/C11H15NO3/c1-12(2)5-10-7-3-4-9(13)11(14)8(7)6-15-10/h3-4,10,13-14H,5-6H2,1-2H3 |
| InChIKey | UIMQDIGDCIXDIY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|