C21H29NO3 — CID 6618709
3-(1-adamantyl)-1-(methylaminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol (PubChem CID 6618709) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 3-(1-adamantyl)-1-(methylaminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol.
| Compound Name | 3-(1-adamantyl)-1-(methylaminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol |
|---|---|
| PubChem CID | 6618709 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 3-(1-adamantyl)-1-(methylaminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol |
| SMILES | CNCC1OC(C23CC4CC(CC(C4)C2)C3)Cc2c1ccc(O)c2O |
| InChI | InChI=1S/C21H29NO3/c1-22-11-18-15-2-3-17(23)20(24)16(15)7-19(25-18)21-8-12-4-13(9-21)6-14(5-12)10-21/h2-3,12-14,18-19,22-24H,4-11H2,1H3 |
| InChIKey | FCLKSVQRZSQLBD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|