C17H26ClNO3 — CID 18641649
(1R,3S)-1-(aminomethyl)-3-cyclohexyl-1,3,4,5-tetrahydro-2-benzoxepine-6,7-diol;hydrochloride (PubChem CID 18641649) has the molecular formula C17H26ClNO3 and a molecular weight of 327.85 g/mol. Its IUPAC name is (1R,3S)-1-(aminomethyl)-3-cyclohexyl-1,3,4,5-tetrahydro-2-benzoxepine-6,7-diol;hydrochloride.
| Compound Name | (1R,3S)-1-(aminomethyl)-3-cyclohexyl-1,3,4,5-tetrahydro-2-benzoxepine-6,7-diol;hydrochloride |
|---|---|
| PubChem CID | 18641649 |
| Molecular Formula | C17H26ClNO3 |
| Molecular Weight | 327.85 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (1R,3S)-1-(aminomethyl)-3-cyclohexyl-1,3,4,5-tetrahydro-2-benzoxepine-6,7-diol;hydrochloride |
| SMILES | Cl.NC[C@@H]1O[C@H](C2CCCCC2)CCc2c1ccc(O)c2O |
| InChI | InChI=1S/C17H25NO3.ClH/c18-10-16-12-6-8-14(19)17(20)13(12)7-9-15(21-16)11-4-2-1-3-5-11;/h6,8,11,15-16,19-20H,1-5,7,9-10,18H2;1H/t15-,16-;/m0./s1 |
| InChIKey | JOXZAKFRBRCKEJ-MOGJOVFKSA-N |
| XLogP | 3.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.85 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|