C18H14ClF3N2O3 — CID 134009998
5-chloro-2-hydroxy-N'-[2-[4-(trifluoromethyl)phenyl]cyclopropanecarbonyl]benzohydrazide (PubChem CID 134009998) has the molecular formula C18H14ClF3N2O3 and a molecular weight of 398.77 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N'-[2-[4-(trifluoromethyl)phenyl]cyclopropanecarbonyl]benzohydrazide.
| Compound Name | 5-chloro-2-hydroxy-N'-[2-[4-(trifluoromethyl)phenyl]cyclopropanecarbonyl]benzohydrazide |
|---|---|
| PubChem CID | 134009998 |
| Molecular Formula | C18H14ClF3N2O3 |
| Molecular Weight | 398.77 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 5-chloro-2-hydroxy-N'-[2-[4-(trifluoromethyl)phenyl]cyclopropanecarbonyl]benzohydrazide |
| SMILES | O=C(NNC(=O)C1CC1c1ccc(C(F)(F)F)cc1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C18H14ClF3N2O3/c19-11-5-6-15(25)14(7-11)17(27)24-23-16(26)13-8-12(13)9-1-3-10(4-2-9)18(20,21)22/h1-7,12-13,25H,8H2,(H,23,26)(H,24,27) |
| InChIKey | ZZDMGTVBFJBEIL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.77 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|