C18H20N2O3 — CID 134015343
cyclohex-3-en-1-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate (PubChem CID 134015343) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is cyclohex-3-en-1-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate.
| Compound Name | cyclohex-3-en-1-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate |
|---|---|
| PubChem CID | 134015343 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | cyclohex-3-en-1-ylmethyl 3-(4-oxocinnolin-1-yl)propanoate |
| SMILES | O=C(CCn1ncc(=O)c2ccccc21)OCC1CC=CCC1 |
| InChI | InChI=1S/C18H20N2O3/c21-17-12-19-20(16-9-5-4-8-15(16)17)11-10-18(22)23-13-14-6-2-1-3-7-14/h1-2,4-5,8-9,12,14H,3,6-7,10-11,13H2 |
| InChIKey | NITHZRCWOCELNA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|