C15H21N3O4 — CID 134071545
3-hydroxy-1-[7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]propan-1-one (PubChem CID 134071545) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-hydroxy-1-[7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]propan-1-one.
| Compound Name | 3-hydroxy-1-[7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 134071545 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-hydroxy-1-[7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]propan-1-one |
| SMILES | O=C(CCO)N1CCOC2C(COc3ncccn3)CCC21 |
| InChI | InChI=1S/C15H21N3O4/c19-8-4-13(20)18-7-9-21-14-11(2-3-12(14)18)10-22-15-16-5-1-6-17-15/h1,5-6,11-12,14,19H,2-4,7-10H2 |
| InChIKey | WFBIPHJLLYLKGT-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |