C16H24N4O3 — CID 97403533
1-[(4aS,7R,7aR)-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(dimethylamino)ethanone (PubChem CID 97403533) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[(4aS,7R,7aR)-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(dimethylamino)ethanone.
| Compound Name | 1-[(4aS,7R,7aR)-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 97403533 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-[(4aS,7R,7aR)-7-(pyrimidin-2-yloxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(dimethylamino)ethanone |
| SMILES | CN(C)CC(=O)N1CCO[C@@H]2[C@@H](COc3ncccn3)CC[C@@H]21 |
| InChI | InChI=1S/C16H24N4O3/c1-19(2)10-14(21)20-8-9-22-15-12(4-5-13(15)20)11-23-16-17-6-3-7-18-16/h3,6-7,12-13,15H,4-5,8-11H2,1-2H3/t12-,13+,15-/m1/s1 |
| InChIKey | BDCHLFJQJYSWPD-VNHYZAJKSA-N |
| XLogP | 0.42 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |