C19H16N2O — CID 134086932
4-phenoxy-2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine (PubChem CID 134086932) has the molecular formula C19H16N2O and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-phenoxy-2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
| Compound Name | 4-phenoxy-2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
|---|---|
| PubChem CID | 134086932 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-phenoxy-2-phenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| SMILES | c1ccc(Oc2nc(-c3ccccc3)nc3c2CCC3)cc1 |
| InChI | InChI=1S/C19H16N2O/c1-3-8-14(9-4-1)18-20-17-13-7-12-16(17)19(21-18)22-15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2 |
| InChIKey | DUSADCSMGYIIEN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |