C16H20F3NOS — CID 134087838
(Z)-N-(2,2-dimethylpropyl)-3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]prop-2-enamide (PubChem CID 134087838) has the molecular formula C16H20F3NOS and a molecular weight of 331.40 g/mol. Its IUPAC name is (Z)-N-(2,2-dimethylpropyl)-3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]prop-2-enamide.
| Compound Name | (Z)-N-(2,2-dimethylpropyl)-3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]prop-2-enamide |
|---|---|
| PubChem CID | 134087838 |
| Molecular Formula | C16H20F3NOS |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (Z)-N-(2,2-dimethylpropyl)-3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]prop-2-enamide |
| SMILES | CC(C)(C)CNC(=O)/C=C\SCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F3NOS/c1-15(2,3)11-20-14(21)7-8-22-10-12-5-4-6-13(9-12)16(17,18)19/h4-9H,10-11H2,1-3H3,(H,20,21)/b8-7- |
| InChIKey | ZOIRMMNSGBLHGD-FPLPWBNLSA-N |
| XLogP | 4.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|