C19H21ClN6O2 — CID 134088652
4-[2-[[4-[(4-chlorophenyl)methylamino]-6-(methoxyamino)-1,3,5-triazin-2-yl]amino]ethyl]phenol (PubChem CID 134088652) has the molecular formula C19H21ClN6O2 and a molecular weight of 400.87 g/mol. Its IUPAC name is 4-[2-[[4-[(4-chlorophenyl)methylamino]-6-(methoxyamino)-1,3,5-triazin-2-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[4-[(4-chlorophenyl)methylamino]-6-(methoxyamino)-1,3,5-triazin-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 134088652 |
| Molecular Formula | C19H21ClN6O2 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 4-[2-[[4-[(4-chlorophenyl)methylamino]-6-(methoxyamino)-1,3,5-triazin-2-yl]amino]ethyl]phenol |
| SMILES | CONc1nc(NCCc2ccc(O)cc2)nc(NCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H21ClN6O2/c1-28-26-19-24-17(21-11-10-13-4-8-16(27)9-5-13)23-18(25-19)22-12-14-2-6-15(20)7-3-14/h2-9,27H,10-12H2,1H3,(H3,21,22,23,24,25,26) |
| InChIKey | CAAKTCQMAIHOSI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|