C11H13N5O7 — CID 134090291
ethyl 2-[[carbamoyl-[(E)-(5-nitrofuran-2-yl)methylideneamino]carbamoyl]amino]acetate (PubChem CID 134090291) has the molecular formula C11H13N5O7 and a molecular weight of 327.25 g/mol. Its IUPAC name is ethyl 2-[[carbamoyl-[(E)-(5-nitrofuran-2-yl)methylideneamino]carbamoyl]amino]acetate.
| Compound Name | ethyl 2-[[carbamoyl-[(E)-(5-nitrofuran-2-yl)methylideneamino]carbamoyl]amino]acetate |
|---|---|
| PubChem CID | 134090291 |
| Molecular Formula | C11H13N5O7 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | ethyl 2-[[carbamoyl-[(E)-(5-nitrofuran-2-yl)methylideneamino]carbamoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N(/N=C/c1ccc([N+](=O)[O-])o1)C(N)=O |
| InChI | InChI=1S/C11H13N5O7/c1-2-22-9(17)6-13-11(19)15(10(12)18)14-5-7-3-4-8(23-7)16(20)21/h3-5H,2,6H2,1H3,(H2,12,18)(H,13,19)/b14-5+ |
| InChIKey | KKZZQZYCNWHZLA-LHHJGKSTSA-N |
| XLogP | 0.18 |
| TPSA | 170.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|