C13H16N8O5 — CID 25242760
ethyl 3-[[4-amino-6-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-1,3,5-triazin-2-yl]amino]propanoate (PubChem CID 25242760) has the molecular formula C13H16N8O5 and a molecular weight of 364.32 g/mol. Its IUPAC name is ethyl 3-[[4-amino-6-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-1,3,5-triazin-2-yl]amino]propanoate.
| Compound Name | ethyl 3-[[4-amino-6-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-1,3,5-triazin-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 25242760 |
| Molecular Formula | C13H16N8O5 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | ethyl 3-[[4-amino-6-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-1,3,5-triazin-2-yl]amino]propanoate |
| SMILES | CCOC(=O)CCNc1nc(N)nc(N/N=C/c2ccc([N+](=O)[O-])o2)n1 |
| InChI | InChI=1S/C13H16N8O5/c1-2-25-10(22)5-6-15-12-17-11(14)18-13(19-12)20-16-7-8-3-4-9(26-8)21(23)24/h3-4,7H,2,5-6H2,1H3,(H4,14,15,17,18,19,20)/b16-7+ |
| InChIKey | JMWRYEYIWHFSSL-FRKPEAEDSA-N |
| XLogP | 0.77 |
| TPSA | 183.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|