C11H11FN6O4 — CID 127243602
2-[[5-fluoro-2-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]pyrimidin-4-yl]amino]ethanol (PubChem CID 127243602) has the molecular formula C11H11FN6O4 and a molecular weight of 310.25 g/mol. Its IUPAC name is 2-[[5-fluoro-2-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[[5-fluoro-2-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 127243602 |
| Molecular Formula | C11H11FN6O4 |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-[[5-fluoro-2-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]pyrimidin-4-yl]amino]ethanol |
| SMILES | O=[N+]([O-])c1ccc(/C=N/Nc2ncc(F)c(NCCO)n2)o1 |
| InChI | InChI=1S/C11H11FN6O4/c12-8-6-14-11(16-10(8)13-3-4-19)17-15-5-7-1-2-9(22-7)18(20)21/h1-2,5-6,19H,3-4H2,(H2,13,14,16,17)/b15-5+ |
| InChIKey | YMWRHIGEBITBCP-PJQLUOCWSA-N |
| XLogP | 0.97 |
| TPSA | 138.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|