C13H7F3N4O3S — CID 86664230
N-[(5-nitrofuran-2-yl)methylideneamino]-6-(trifluoromethyl)-1,3-benzothiazol-2-amine (PubChem CID 86664230) has the molecular formula C13H7F3N4O3S and a molecular weight of 356.29 g/mol. Its IUPAC name is N-[(5-nitrofuran-2-yl)methylideneamino]-6-(trifluoromethyl)-1,3-benzothiazol-2-amine.
| Compound Name | N-[(5-nitrofuran-2-yl)methylideneamino]-6-(trifluoromethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 86664230 |
| Molecular Formula | C13H7F3N4O3S |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | N-[(5-nitrofuran-2-yl)methylideneamino]-6-(trifluoromethyl)-1,3-benzothiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(C=NNc2nc3ccc(C(F)(F)F)cc3s2)o1 |
| InChI | InChI=1S/C13H7F3N4O3S/c14-13(15,16)7-1-3-9-10(5-7)24-12(18-9)19-17-6-8-2-4-11(23-8)20(21)22/h1-6H,(H,18,19) |
| InChIKey | UWVCEJGIODPGJR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|