C14H22N6O5 — CID 134111809
1-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea (PubChem CID 134111809) has the molecular formula C14H22N6O5 and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea.
| Compound Name | 1-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 134111809 |
| Molecular Formula | C14H22N6O5 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea |
| SMILES | NC(=O)N(CCN1CCN(CCO)CC1)/N=C/c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C14H22N6O5/c15-14(22)19(16-11-12-1-2-13(25-12)20(23)24)8-7-17-3-5-18(6-4-17)9-10-21/h1-2,11,21H,3-10H2,(H2,15,22)/b16-11+ |
| InChIKey | GLOWHTLSMAECQV-LFIBNONCSA-N |
| XLogP | -0.49 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|