C11H10N4O8 — CID 57093407
2-(2-hydroxyethyl)-5-nitro-3-[(5-nitrofuran-2-yl)methylidene]-1H-pyrazole-4-carboxylic acid (PubChem CID 57093407) has the molecular formula C11H10N4O8 and a molecular weight of 326.22 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-5-nitro-3-[(5-nitrofuran-2-yl)methylidene]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 2-(2-hydroxyethyl)-5-nitro-3-[(5-nitrofuran-2-yl)methylidene]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 57093407 |
| Molecular Formula | C11H10N4O8 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-(2-hydroxyethyl)-5-nitro-3-[(5-nitrofuran-2-yl)methylidene]-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)C1=C([N+](=O)[O-])NN(CCO)C1=Cc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H10N4O8/c16-4-3-13-7(5-6-1-2-8(23-6)14(19)20)9(11(17)18)10(12-13)15(21)22/h1-2,5,12,16H,3-4H2,(H,17,18) |
| InChIKey | YCBWXDYFSLMWAL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 172.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|