C21H18N2O2 — CID 134095322
3-benzyl-1-phenyl-9aH-pyrido[1,2-a]pyrimidine-2,4-dione (PubChem CID 134095322) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-benzyl-1-phenyl-9aH-pyrido[1,2-a]pyrimidine-2,4-dione.
| Compound Name | 3-benzyl-1-phenyl-9aH-pyrido[1,2-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134095322 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-benzyl-1-phenyl-9aH-pyrido[1,2-a]pyrimidine-2,4-dione |
| SMILES | O=C1C(Cc2ccccc2)C(=O)N(c2ccccc2)C2C=CC=CN12 |
| InChI | InChI=1S/C21H18N2O2/c24-20-18(15-16-9-3-1-4-10-16)21(25)23(17-11-5-2-6-12-17)19-13-7-8-14-22(19)20/h1-14,18-19H,15H2 |
| InChIKey | NMVKRMZMWGAPAG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|