C12H11F3N2O3 — CID 134096916
1-(2-oxooxolan-3-yl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 134096916) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.22 g/mol. Its IUPAC name is 1-(2-oxooxolan-3-yl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-oxooxolan-3-yl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 134096916 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1-(2-oxooxolan-3-yl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)NC1CCOC1=O |
| InChI | InChI=1S/C12H11F3N2O3/c13-12(14,15)7-2-1-3-8(6-7)16-11(19)17-9-4-5-20-10(9)18/h1-3,6,9H,4-5H2,(H2,16,17,19) |
| InChIKey | VQCGDPONFLKGMM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |